C11H11Cl2N5O — CID 100818916
1-(3,4-dichlorophenyl)-3-(3,5-dimethyl-1,2,4-triazol-4-yl)urea (PubChem CID 100818916) has the molecular formula C11H11Cl2N5O and a molecular weight of 300.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(3,5-dimethyl-1,2,4-triazol-4-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(3,5-dimethyl-1,2,4-triazol-4-yl)urea |
|---|---|
| PubChem CID | 100818916 |
| Molecular Formula | C11H11Cl2N5O |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(3,5-dimethyl-1,2,4-triazol-4-yl)urea |
| SMILES | Cc1nnc(C)n1NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2N5O/c1-6-15-16-7(2)18(6)17-11(19)14-8-3-4-9(12)10(13)5-8/h3-5H,1-2H3,(H2,14,17,19) |
| InChIKey | ZAUYFDMYURUBIB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |