C10H10ClN5O — CID 17278361
1-(3-chloro-4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea (PubChem CID 17278361) has the molecular formula C10H10ClN5O and a molecular weight of 251.68 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea |
|---|---|
| PubChem CID | 17278361 |
| Molecular Formula | C10H10ClN5O |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-(1,2,4-triazol-4-yl)urea |
| SMILES | Cc1ccc(NC(=O)Nn2cnnc2)cc1Cl |
| InChI | InChI=1S/C10H10ClN5O/c1-7-2-3-8(4-9(7)11)14-10(17)15-16-5-12-13-6-16/h2-6H,1H3,(H2,14,15,17) |
| InChIKey | NLKZVBYUDYDZDU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |