C15H10Cl3N5OS — CID 2121673
1-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-(3,4-dichlorophenyl)urea (PubChem CID 2121673) has the molecular formula C15H10Cl3N5OS and a molecular weight of 414.71 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 2121673 |
| Molecular Formula | C15H10Cl3N5OS |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nn1c(-c2ccc(Cl)cc2)n[nH]c1=S |
| InChI | InChI=1S/C15H10Cl3N5OS/c16-9-3-1-8(2-4-9)13-20-21-15(25)23(13)22-14(24)19-10-5-6-11(17)12(18)7-10/h1-7H,(H,21,25)(H2,19,22,24) |
| InChIKey | PKOMWKAKBKMSQQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|