C15H12ClN7S2 — CID 73426408
1-[(Z)-(2-chlorophenyl)methylideneamino]-3-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)thiourea (PubChem CID 73426408) has the molecular formula C15H12ClN7S2 and a molecular weight of 389.90 g/mol. Its IUPAC name is 1-[(Z)-(2-chlorophenyl)methylideneamino]-3-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)thiourea.
| Compound Name | 1-[(Z)-(2-chlorophenyl)methylideneamino]-3-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)thiourea |
|---|---|
| PubChem CID | 73426408 |
| Molecular Formula | C15H12ClN7S2 |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 1-[(Z)-(2-chlorophenyl)methylideneamino]-3-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)thiourea |
| SMILES | S=C(N/N=C\c1ccccc1Cl)Nn1c(-c2ccncc2)n[nH]c1=S |
| InChI | InChI=1S/C15H12ClN7S2/c16-12-4-2-1-3-11(12)9-18-20-14(24)22-23-13(19-21-15(23)25)10-5-7-17-8-6-10/h1-9H,(H,21,25)(H2,20,22,24)/b18-9- |
| InChIKey | ZFBHZWSRZMSJEI-NVMNQCDNSA-N |
| XLogP | 3.11 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|