C24H22ClNO5 — CID 23043626
2-(3-chloro-2-hydroxyphenyl)-N-[4-[2-(3,4-dimethoxyphenyl)ethyl]phenyl]-2-oxoacetamide (PubChem CID 23043626) has the molecular formula C24H22ClNO5 and a molecular weight of 439.90 g/mol. Its IUPAC name is 2-(3-chloro-2-hydroxyphenyl)-N-[4-[2-(3,4-dimethoxyphenyl)ethyl]phenyl]-2-oxoacetamide.
| Compound Name | 2-(3-chloro-2-hydroxyphenyl)-N-[4-[2-(3,4-dimethoxyphenyl)ethyl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 23043626 |
| Molecular Formula | C24H22ClNO5 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-(3-chloro-2-hydroxyphenyl)-N-[4-[2-(3,4-dimethoxyphenyl)ethyl]phenyl]-2-oxoacetamide |
| SMILES | COc1ccc(CCc2ccc(NC(=O)C(=O)c3cccc(Cl)c3O)cc2)cc1OC |
| InChI | InChI=1S/C24H22ClNO5/c1-30-20-13-10-16(14-21(20)31-2)7-6-15-8-11-17(12-9-15)26-24(29)23(28)18-4-3-5-19(25)22(18)27/h3-5,8-14,27H,6-7H2,1-2H3,(H,26,29) |
| InChIKey | YEVSYPOZVWKTCV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|