C18H22O4 — CID 23043876
[3,4-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]phenyl]methanol (PubChem CID 23043876) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [3,4-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]phenyl]methanol.
| Compound Name | [3,4-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]phenyl]methanol |
|---|---|
| PubChem CID | 23043876 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [3,4-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]phenyl]methanol |
| SMILES | COc1ccc(CCc2c(CO)ccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C18H22O4/c1-20-15-8-4-13(5-9-15)6-10-16-14(12-19)7-11-17(21-2)18(16)22-3/h4-5,7-9,11,19H,6,10,12H2,1-3H3 |
| InChIKey | UWPKYKRYZMRVQS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |