1,3-benzothiazol-2-ylmethyl acetate

C10H9NO2S — CID 2304534

IUPAC1,3-benzothiazol-2-ylmethyl acetate
SMILESCC(=O)OCc1nc2ccccc2s1
InChIInChI=1S/C10H9NO2S/c1-7(12)13-6-10-11-8-4-2-3-5-9(8)14-10/h2-5H,6H2,1H3
InChIKeyWETWJLYPOUEQMO-UHFFFAOYSA-N
MW207.25 g/mol
LogP2.36
Rot. Bonds2

About 1,3-benzothiazol-2-ylmethyl acetate

1,3-benzothiazol-2-ylmethyl acetate (PubChem CID 2304534) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl acetate.

Molecular Properties

Compound Name1,3-benzothiazol-2-ylmethyl acetate
PubChem CID2304534
Molecular FormulaC10H9NO2S
Molecular Weight207.25 g/mol
Exact Mass207.04
IUPAC Name1,3-benzothiazol-2-ylmethyl acetate
SMILESCC(=O)OCc1nc2ccccc2s1
InChIInChI=1S/C10H9NO2S/c1-7(12)13-6-10-11-8-4-2-3-5-9(8)14-10/h2-5H,6H2,1H3
InChIKeyWETWJLYPOUEQMO-UHFFFAOYSA-N
XLogP2.36
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.25
LogP ≤ 52.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1,3-benzothiazol-2-ylmethyl acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzothiazol-2-ylmethyl acetate?
The IUPAC name of 1,3-benzothiazol-2-ylmethyl acetate (CID 2304534) is 1,3-benzothiazol-2-ylmethyl acetate.
What is the SMILES notation for 1,3-benzothiazol-2-ylmethyl acetate?
The canonical SMILES for 1,3-benzothiazol-2-ylmethyl acetate is CC(=O)OCc1nc2ccccc2s1.
What is the InChIKey of 1,3-benzothiazol-2-ylmethyl acetate?
The InChIKey is WETWJLYPOUEQMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S/c1-7(12)13-6-10-11-8-4-2-3-5-9(8)14-10/h2-5H,6H2,1H3.
What are the key properties of 1,3-benzothiazol-2-ylmethyl acetate?
1,3-benzothiazol-2-ylmethyl acetate has a molecular weight of 207.25 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylmethyl acetate is sourced from PubChem (CID 2304534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).