C11H10ClNOS — CID 23046142
1-(7-chlorothieno[3,2-b]pyridin-6-yl)butan-1-one (PubChem CID 23046142) has the molecular formula C11H10ClNOS and a molecular weight of 239.73 g/mol. Its IUPAC name is 1-(7-chlorothieno[3,2-b]pyridin-6-yl)butan-1-one.
| Compound Name | 1-(7-chlorothieno[3,2-b]pyridin-6-yl)butan-1-one |
|---|---|
| PubChem CID | 23046142 |
| Molecular Formula | C11H10ClNOS |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 1-(7-chlorothieno[3,2-b]pyridin-6-yl)butan-1-one |
| SMILES | CCCC(=O)c1cnc2ccsc2c1Cl |
| InChI | InChI=1S/C11H10ClNOS/c1-2-3-9(14)7-6-13-8-4-5-15-11(8)10(7)12/h4-6H,2-3H2,1H3 |
| InChIKey | NIYKLCDOTPBTEC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |