C25H27ClO4S — CID 23047898
ethyl 7-(4-chlorophenyl)-2-naphthalen-1-ylsulfonylheptanoate (PubChem CID 23047898) has the molecular formula C25H27ClO4S and a molecular weight of 459.01 g/mol. Its IUPAC name is ethyl 7-(4-chlorophenyl)-2-naphthalen-1-ylsulfonylheptanoate.
| Compound Name | ethyl 7-(4-chlorophenyl)-2-naphthalen-1-ylsulfonylheptanoate |
|---|---|
| PubChem CID | 23047898 |
| Molecular Formula | C25H27ClO4S |
| Molecular Weight | 459.01 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | ethyl 7-(4-chlorophenyl)-2-naphthalen-1-ylsulfonylheptanoate |
| SMILES | CCOC(=O)C(CCCCCc1ccc(Cl)cc1)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H27ClO4S/c1-2-30-25(27)24(13-5-3-4-9-19-15-17-21(26)18-16-19)31(28,29)23-14-8-11-20-10-6-7-12-22(20)23/h6-8,10-12,14-18,24H,2-5,9,13H2,1H3 |
| InChIKey | PWGSYSVZQLZWHK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.01 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|