C28H39N5O2 — CID 23048779
1,3-dimethyl-10-[3-(4-piperidin-1-ylbutyl)piperidine-1-carbonyl]-5H-pyrrolo[2,3-c][1,5]benzodiazepin-4-one (PubChem CID 23048779) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 1,3-dimethyl-10-[3-(4-piperidin-1-ylbutyl)piperidine-1-carbonyl]-5H-pyrrolo[2,3-c][1,5]benzodiazepin-4-one.
| Compound Name | 1,3-dimethyl-10-[3-(4-piperidin-1-ylbutyl)piperidine-1-carbonyl]-5H-pyrrolo[2,3-c][1,5]benzodiazepin-4-one |
|---|---|
| PubChem CID | 23048779 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 1,3-dimethyl-10-[3-(4-piperidin-1-ylbutyl)piperidine-1-carbonyl]-5H-pyrrolo[2,3-c][1,5]benzodiazepin-4-one |
| SMILES | Cc1cn(C)c2c1N(C(=O)N1CCCC(CCCCN3CCCCC3)C1)c1ccccc1NC2=O |
| InChI | InChI=1S/C28H39N5O2/c1-21-19-30(2)26-25(21)33(24-14-5-4-13-23(24)29-27(26)34)28(35)32-18-10-12-22(20-32)11-6-9-17-31-15-7-3-8-16-31/h4-5,13-14,19,22H,3,6-12,15-18,20H2,1-2H3,(H,29,34) |
| InChIKey | RYIZUPRZDDIVLZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 60.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|