C15H35NO7P2 — CID 23051095
[1-hydroxy-4-[methyl(nonyl)amino]-1-phosphonopentyl]phosphonic acid (PubChem CID 23051095) has the molecular formula C15H35NO7P2 and a molecular weight of 403.39 g/mol. Its IUPAC name is [1-hydroxy-4-[methyl(nonyl)amino]-1-phosphonopentyl]phosphonic acid.
| Compound Name | [1-hydroxy-4-[methyl(nonyl)amino]-1-phosphonopentyl]phosphonic acid |
|---|---|
| PubChem CID | 23051095 |
| Molecular Formula | C15H35NO7P2 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [1-hydroxy-4-[methyl(nonyl)amino]-1-phosphonopentyl]phosphonic acid |
| SMILES | CCCCCCCCCN(C)C(C)CCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C15H35NO7P2/c1-4-5-6-7-8-9-10-13-16(3)14(2)11-12-15(17,24(18,19)20)25(21,22)23/h14,17H,4-13H2,1-3H3,(H2,18,19,20)(H2,21,22,23) |
| InChIKey | YXDDWGDPNRXNPE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|