C14H35NNaO8P2+ — CID 11539227
sodium;[1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl]phosphonic acid;pentan-1-ol (PubChem CID 11539227) has the molecular formula C14H35NNaO8P2+ and a molecular weight of 430.37 g/mol. Its IUPAC name is sodium;[1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl]phosphonic acid;pentan-1-ol.
| Compound Name | sodium;[1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl]phosphonic acid;pentan-1-ol |
|---|---|
| PubChem CID | 11539227 |
| Molecular Formula | C14H35NNaO8P2+ |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | sodium;[1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl]phosphonic acid;pentan-1-ol |
| SMILES | CCCCCN(C)CCC(O)(P(=O)(O)O)P(=O)(O)O.CCCCCO.[Na+] |
| InChI | InChI=1S/C9H23NO7P2.C5H12O.Na/c1-3-4-5-7-10(2)8-6-9(11,18(12,13)14)19(15,16)17;1-2-3-4-5-6;/h11H,3-8H2,1-2H3,(H2,12,13,14)(H2,15,16,17);6H,2-5H2,1H3;/q;;+1 |
| InChIKey | KODMEOVYWOYQLL-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|