C9H21NO7P2Sr — CID 45377824
strontium hydroxy-[1-hydroxy-1-[hydroxy(oxido)phosphoryl]-3-[methyl(pentyl)amino]propyl]phosphinate (PubChem CID 45377824) has the molecular formula C9H21NO7P2Sr and a molecular weight of 404.84 g/mol. Its IUPAC name is strontium hydroxy-[1-hydroxy-1-[hydroxy(oxido)phosphoryl]-3-[methyl(pentyl)amino]propyl]phosphinate.
| Compound Name | strontium hydroxy-[1-hydroxy-1-[hydroxy(oxido)phosphoryl]-3-[methyl(pentyl)amino]propyl]phosphinate |
|---|---|
| PubChem CID | 45377824 |
| Molecular Formula | C9H21NO7P2Sr |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | strontium hydroxy-[1-hydroxy-1-[hydroxy(oxido)phosphoryl]-3-[methyl(pentyl)amino]propyl]phosphinate |
| SMILES | CCCCCN(C)CCC(O)(P(=O)([O-])O)P(=O)([O-])O.[Sr+2] |
| InChI | InChI=1S/C9H23NO7P2.Sr/c1-3-4-5-7-10(2)8-6-9(11,18(12,13)14)19(15,16)17;/h11H,3-8H2,1-2H3,(H2,12,13,14)(H2,15,16,17);/q;+2/p-2 |
| InChIKey | LZDKABZWMJNYFT-UHFFFAOYSA-L |
| XLogP | -1.14 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|