C5H13NO7P2Zn — CID 46918109
zinc [3-(dimethylamino)-1-hydroxy-1-[hydroxy(oxido)phosphoryl]propyl]-hydroxyphosphinate (PubChem CID 46918109) has the molecular formula C5H13NO7P2Zn and a molecular weight of 326.50 g/mol. Its IUPAC name is zinc [3-(dimethylamino)-1-hydroxy-1-[hydroxy(oxido)phosphoryl]propyl]-hydroxyphosphinate.
| Compound Name | zinc [3-(dimethylamino)-1-hydroxy-1-[hydroxy(oxido)phosphoryl]propyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 46918109 |
| Molecular Formula | C5H13NO7P2Zn |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 324.95 |
| IUPAC Name | zinc [3-(dimethylamino)-1-hydroxy-1-[hydroxy(oxido)phosphoryl]propyl]-hydroxyphosphinate |
| SMILES | CN(C)CCC(O)(P(=O)([O-])O)P(=O)([O-])O.[Zn+2] |
| InChI | InChI=1S/C5H15NO7P2.Zn/c1-6(2)4-3-5(7,14(8,9)10)15(11,12)13;/h7H,3-4H2,1-2H3,(H2,8,9,10)(H2,11,12,13);/q;+2/p-2 |
| InChIKey | CDNJZVIQWTXUJF-UHFFFAOYSA-L |
| XLogP | -2.33 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|