C14H33N3O3 — CID 88768729
4-(dimethylamino)-2,2-bis[2-(dimethylamino)ethyl]butane-1,1,1-triol (PubChem CID 88768729) has the molecular formula C14H33N3O3 and a molecular weight of 291.44 g/mol. Its IUPAC name is 4-(dimethylamino)-2,2-bis[2-(dimethylamino)ethyl]butane-1,1,1-triol.
| Compound Name | 4-(dimethylamino)-2,2-bis[2-(dimethylamino)ethyl]butane-1,1,1-triol |
|---|---|
| PubChem CID | 88768729 |
| Molecular Formula | C14H33N3O3 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.25 |
| IUPAC Name | 4-(dimethylamino)-2,2-bis[2-(dimethylamino)ethyl]butane-1,1,1-triol |
| SMILES | CN(C)CCC(CCN(C)C)(CCN(C)C)C(O)(O)O |
| InChI | InChI=1S/C14H33N3O3/c1-15(2)10-7-13(14(18,19)20,8-11-16(3)4)9-12-17(5)6/h18-20H,7-12H2,1-6H3 |
| InChIKey | CAXFTARBNGKSAT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|