C10H25NO7P2 — CID 71749147
[3-[2,2-dimethylbutyl(methyl)amino]-1-hydroxy-1-phosphonopropyl]phosphonic acid (PubChem CID 71749147) has the molecular formula C10H25NO7P2 and a molecular weight of 333.26 g/mol. Its IUPAC name is [3-[2,2-dimethylbutyl(methyl)amino]-1-hydroxy-1-phosphonopropyl]phosphonic acid.
| Compound Name | [3-[2,2-dimethylbutyl(methyl)amino]-1-hydroxy-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 71749147 |
| Molecular Formula | C10H25NO7P2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [3-[2,2-dimethylbutyl(methyl)amino]-1-hydroxy-1-phosphonopropyl]phosphonic acid |
| SMILES | CCC(C)(C)CN(C)CCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C10H25NO7P2/c1-5-9(2,3)8-11(4)7-6-10(12,19(13,14)15)20(16,17)18/h12H,5-8H2,1-4H3,(H2,13,14,15)(H2,16,17,18) |
| InChIKey | PWSOTTWRYVSTJJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|