C19H47N2O15P5 — CID 158911689
[1-hydroxy-1-[hydroxy-[hydroxy-[[hydroxy-[1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl]phosphoryl]methyl]phosphoryl]oxyphosphoryl]-3-[methyl(pentyl)amino]propyl]phosphonic acid (PubChem CID 158911689) has the molecular formula C19H47N2O15P5 and a molecular weight of 698.45 g/mol. Its IUPAC name is [1-hydroxy-1-[hydroxy-[hydroxy-[[hydroxy-[1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl]phosphoryl]methyl]phosphoryl]oxyphosphoryl]-3-[methyl(pentyl)amino]propyl]phosphonic acid.
| Compound Name | [1-hydroxy-1-[hydroxy-[hydroxy-[[hydroxy-[1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl]phosphoryl]methyl]phosphoryl]oxyphosphoryl]-3-[methyl(pentyl)amino]propyl]phosphonic acid |
|---|---|
| PubChem CID | 158911689 |
| Molecular Formula | C19H47N2O15P5 |
| Molecular Weight | 698.45 g/mol |
| Exact Mass | 698.17 |
| IUPAC Name | [1-hydroxy-1-[hydroxy-[hydroxy-[[hydroxy-[1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl]phosphoryl]methyl]phosphoryl]oxyphosphoryl]-3-[methyl(pentyl)amino]propyl]phosphonic acid |
| SMILES | CCCCCN(C)CCC(O)(P(=O)(O)O)P(=O)(O)CP(=O)(O)OP(=O)(O)C(O)(CCN(C)CCCCC)P(=O)(O)O |
| InChI | InChI=1S/C19H47N2O15P5/c1-5-7-9-13-20(3)15-11-18(22,39(28,29)30)37(24,25)17-38(26,27)36-41(34,35)19(23,40(31,32)33)12-16-21(4)14-10-8-6-2/h22-23H,5-17H2,1-4H3,(H,24,25)(H,26,27)(H,34,35)(H2,28,29,30)(H2,31,32,33) |
| InChIKey | QAWJRLOHRQOVOM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 283.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|