C9H23NO7P2 — CID 54229980
[1-hydroxy-2-[methyl(pentyl)amino]-1-phosphonopropyl]phosphonic acid (PubChem CID 54229980) has the molecular formula C9H23NO7P2 and a molecular weight of 319.23 g/mol. Its IUPAC name is [1-hydroxy-2-[methyl(pentyl)amino]-1-phosphonopropyl]phosphonic acid.
| Compound Name | [1-hydroxy-2-[methyl(pentyl)amino]-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 54229980 |
| Molecular Formula | C9H23NO7P2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | [1-hydroxy-2-[methyl(pentyl)amino]-1-phosphonopropyl]phosphonic acid |
| SMILES | CCCCCN(C)C(C)C(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H23NO7P2/c1-4-5-6-7-10(3)8(2)9(11,18(12,13)14)19(15,16)17/h8,11H,4-7H2,1-3H3,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | QIOGTJHHFAXAQR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|