C27H35N3O2 — CID 23051632
(E)-3-(6-methoxy-1-methyl-3-pentylindol-2-yl)-N-(4-pyridin-3-ylbutyl)prop-2-enamide (PubChem CID 23051632) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is (E)-3-(6-methoxy-1-methyl-3-pentylindol-2-yl)-N-(4-pyridin-3-ylbutyl)prop-2-enamide.
| Compound Name | (E)-3-(6-methoxy-1-methyl-3-pentylindol-2-yl)-N-(4-pyridin-3-ylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 23051632 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | (E)-3-(6-methoxy-1-methyl-3-pentylindol-2-yl)-N-(4-pyridin-3-ylbutyl)prop-2-enamide |
| SMILES | CCCCCc1c(/C=C/C(=O)NCCCCc2cccnc2)n(C)c2cc(OC)ccc12 |
| InChI | InChI=1S/C27H35N3O2/c1-4-5-6-12-23-24-14-13-22(32-3)19-26(24)30(2)25(23)15-16-27(31)29-18-8-7-10-21-11-9-17-28-20-21/h9,11,13-17,19-20H,4-8,10,12,18H2,1-3H3,(H,29,31)/b16-15+ |
| InChIKey | QKJZSEQNWVZGMX-FOCLMDBBSA-N |
| XLogP | 5.47 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|