C29H39N3O — CID 54492471
3-(1,6-dimethyl-3-pentylindol-2-yl)-N-[(3R)-6-pyridin-3-ylhexan-3-yl]prop-2-enamide (PubChem CID 54492471) has the molecular formula C29H39N3O and a molecular weight of 445.65 g/mol. Its IUPAC name is 3-(1,6-dimethyl-3-pentylindol-2-yl)-N-[(3R)-6-pyridin-3-ylhexan-3-yl]prop-2-enamide.
| Compound Name | 3-(1,6-dimethyl-3-pentylindol-2-yl)-N-[(3R)-6-pyridin-3-ylhexan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 54492471 |
| Molecular Formula | C29H39N3O |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | 3-(1,6-dimethyl-3-pentylindol-2-yl)-N-[(3R)-6-pyridin-3-ylhexan-3-yl]prop-2-enamide |
| SMILES | CCCCCc1c(C=CC(=O)N[C@H](CC)CCCc2cccnc2)n(C)c2cc(C)ccc12 |
| InChI | InChI=1S/C29H39N3O/c1-5-7-8-14-25-26-16-15-22(3)20-28(26)32(4)27(25)17-18-29(33)31-24(6-2)13-9-11-23-12-10-19-30-21-23/h10,12,15-21,24H,5-9,11,13-14H2,1-4H3,(H,31,33)/t24-/m1/s1 |
| InChIKey | XWRYBIXTEOAOEC-XMMPIXPASA-N |
| XLogP | 6.55 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|