C29H34N2O — CID 23051537
5,5-bis(3-methylphenyl)-N-(5-pyridin-3-ylpentan-2-yl)pent-4-enamide (PubChem CID 23051537) has the molecular formula C29H34N2O and a molecular weight of 426.60 g/mol. Its IUPAC name is 5,5-bis(3-methylphenyl)-N-(5-pyridin-3-ylpentan-2-yl)pent-4-enamide.
| Compound Name | 5,5-bis(3-methylphenyl)-N-(5-pyridin-3-ylpentan-2-yl)pent-4-enamide |
|---|---|
| PubChem CID | 23051537 |
| Molecular Formula | C29H34N2O |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 5,5-bis(3-methylphenyl)-N-(5-pyridin-3-ylpentan-2-yl)pent-4-enamide |
| SMILES | Cc1cccc(C(=CCCC(=O)NC(C)CCCc2cccnc2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C29H34N2O/c1-22-9-4-14-26(19-22)28(27-15-5-10-23(2)20-27)16-7-17-29(32)31-24(3)11-6-12-25-13-8-18-30-21-25/h4-5,8-10,13-16,18-21,24H,6-7,11-12,17H2,1-3H3,(H,31,32) |
| InChIKey | UXYFKENTXQHGJZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |