C27H28Cl2N2O — CID 23051645
5,5-bis(3-chlorophenyl)-N-(5-pyridin-3-ylpentan-2-yl)pent-4-enamide (PubChem CID 23051645) has the molecular formula C27H28Cl2N2O and a molecular weight of 467.44 g/mol. Its IUPAC name is 5,5-bis(3-chlorophenyl)-N-(5-pyridin-3-ylpentan-2-yl)pent-4-enamide.
| Compound Name | 5,5-bis(3-chlorophenyl)-N-(5-pyridin-3-ylpentan-2-yl)pent-4-enamide |
|---|---|
| PubChem CID | 23051645 |
| Molecular Formula | C27H28Cl2N2O |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 5,5-bis(3-chlorophenyl)-N-(5-pyridin-3-ylpentan-2-yl)pent-4-enamide |
| SMILES | CC(CCCc1cccnc1)NC(=O)CCC=C(c1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H28Cl2N2O/c1-20(7-2-8-21-9-6-16-30-19-21)31-27(32)15-5-14-26(22-10-3-12-24(28)17-22)23-11-4-13-25(29)18-23/h3-4,6,9-14,16-20H,2,5,7-8,15H2,1H3,(H,31,32) |
| InChIKey | LSFFYPIZASNQLD-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |