C27H26Cl4N2O — CID 54132605
5,5-bis(3,4-dichlorophenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]pent-4-enamide (PubChem CID 54132605) has the molecular formula C27H26Cl4N2O and a molecular weight of 536.33 g/mol. Its IUPAC name is 5,5-bis(3,4-dichlorophenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]pent-4-enamide.
| Compound Name | 5,5-bis(3,4-dichlorophenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]pent-4-enamide |
|---|---|
| PubChem CID | 54132605 |
| Molecular Formula | C27H26Cl4N2O |
| Molecular Weight | 536.33 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | 5,5-bis(3,4-dichlorophenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]pent-4-enamide |
| SMILES | C[C@H](CCCc1cccnc1)NC(=O)CCC=C(c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H26Cl4N2O/c1-18(5-2-6-19-7-4-14-32-17-19)33-27(34)9-3-8-22(20-10-12-23(28)25(30)15-20)21-11-13-24(29)26(31)16-21/h4,7-8,10-18H,2-3,5-6,9H2,1H3,(H,33,34)/t18-/m1/s1 |
| InChIKey | NVKDMSZSVRESLC-GOSISDBHSA-N |
| XLogP | 8.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.33 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |