C11H9F3N4O2 — CID 23055532
methyl 3-amino-5-[3-(trifluoromethyl)-2-pyridinyl]-1H-pyrazole-4-carboxylate (PubChem CID 23055532) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is methyl 3-amino-5-[3-(trifluoromethyl)-2-pyridinyl]-1H-pyrazole-4-carboxylate.
| Compound Name | methyl 3-amino-5-[3-(trifluoromethyl)-2-pyridinyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 23055532 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | methyl 3-amino-5-[3-(trifluoromethyl)-2-pyridinyl]-1H-pyrazole-4-carboxylate |
| SMILES | COC(=O)c1c(N)n[nH]c1-c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C11H9F3N4O2/c1-20-10(19)6-8(17-18-9(6)15)7-5(11(12,13)14)3-2-4-16-7/h2-4H,1H3,(H3,15,17,18) |
| InChIKey | UZNVSKPYPKNPGP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |