About 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline
4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline (PubChem CID 23057759) has the molecular formula C10H14N2OS
and a molecular weight of 210.30 g/mol. Its IUPAC name is 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline.
Molecular Properties
| Compound Name | 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline |
| PubChem CID | 23057759 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline |
| SMILES | Cc1nc(S(C)=O)nc2c1CCCC2 |
| InChI | InChI=1S/C10H14N2OS/c1-7-8-5-3-4-6-9(8)12-10(11-7)14(2)13/h3-6H2,1-2H3 |
| InChIKey | XSMNRLKGDJFYTJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline?
The IUPAC name of 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline (CID 23057759) is 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline.
What is the SMILES notation for 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline?
The canonical SMILES for 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline is Cc1nc(S(C)=O)nc2c1CCCC2.
What is the InChIKey of 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline?
The InChIKey is XSMNRLKGDJFYTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS/c1-7-8-5-3-4-6-9(8)12-10(11-7)14(2)13/h3-6H2,1-2H3.
What are the key properties of 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline?
4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline has a molecular weight of 210.30 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-methylsulfinyl-5,6,7,8-tetrahydroquinazoline is sourced from PubChem (CID 23057759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).