C15H10ClN3O4 — CID 23062593
3-amino-2-[(5-chloro-2-pyridinyl)carbamoyl]-1-benzofuran-5-carboxylic acid (PubChem CID 23062593) has the molecular formula C15H10ClN3O4 and a molecular weight of 331.72 g/mol. Its IUPAC name is 3-amino-2-[(5-chloro-2-pyridinyl)carbamoyl]-1-benzofuran-5-carboxylic acid.
| Compound Name | 3-amino-2-[(5-chloro-2-pyridinyl)carbamoyl]-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 23062593 |
| Molecular Formula | C15H10ClN3O4 |
| Molecular Weight | 331.72 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 3-amino-2-[(5-chloro-2-pyridinyl)carbamoyl]-1-benzofuran-5-carboxylic acid |
| SMILES | Nc1c(C(=O)Nc2ccc(Cl)cn2)oc2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C15H10ClN3O4/c16-8-2-4-11(18-6-8)19-14(20)13-12(17)9-5-7(15(21)22)1-3-10(9)23-13/h1-6H,17H2,(H,21,22)(H,18,19,20) |
| InChIKey | HOYRUMHPUDAXKX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |