C18H34N4O4S2 — CID 23064407
2-acetamido-N-[2-[(2-acetamido-4-sulfanylbutanoyl)amino]hexyl]-4-sulfanylbutanamide (PubChem CID 23064407) has the molecular formula C18H34N4O4S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is 2-acetamido-N-[2-[(2-acetamido-4-sulfanylbutanoyl)amino]hexyl]-4-sulfanylbutanamide.
| Compound Name | 2-acetamido-N-[2-[(2-acetamido-4-sulfanylbutanoyl)amino]hexyl]-4-sulfanylbutanamide |
|---|---|
| PubChem CID | 23064407 |
| Molecular Formula | C18H34N4O4S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-acetamido-N-[2-[(2-acetamido-4-sulfanylbutanoyl)amino]hexyl]-4-sulfanylbutanamide |
| SMILES | CCCCC(CNC(=O)C(CCS)NC(C)=O)NC(=O)C(CCS)NC(C)=O |
| InChI | InChI=1S/C18H34N4O4S2/c1-4-5-6-14(22-18(26)16(8-10-28)21-13(3)24)11-19-17(25)15(7-9-27)20-12(2)23/h14-16,27-28H,4-11H2,1-3H3,(H,19,25)(H,20,23)(H,21,24)(H,22,26) |
| InChIKey | OIGFYFDHZDYKKO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|