C20H24N4O2S — CID 23067399
2-amino-N-(4-methyl-1,3-thiazol-2-yl)-5-phenoxybenzamide;N,N-dimethylmethanamine (PubChem CID 23067399) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 2-amino-N-(4-methyl-1,3-thiazol-2-yl)-5-phenoxybenzamide;N,N-dimethylmethanamine.
| Compound Name | 2-amino-N-(4-methyl-1,3-thiazol-2-yl)-5-phenoxybenzamide;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 23067399 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-amino-N-(4-methyl-1,3-thiazol-2-yl)-5-phenoxybenzamide;N,N-dimethylmethanamine |
| SMILES | CN(C)C.Cc1csc(NC(=O)c2cc(Oc3ccccc3)ccc2N)n1 |
| InChI | InChI=1S/C17H15N3O2S.C3H9N/c1-11-10-23-17(19-11)20-16(21)14-9-13(7-8-15(14)18)22-12-5-3-2-4-6-12;1-4(2)3/h2-10H,18H2,1H3,(H,19,20,21);1-3H3 |
| InChIKey | SWMIPZIPKGRLGU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|