C20H22N4O2S — CID 58929203
2-amino-5-[2-[(dimethylamino)methyl]phenoxy]-N-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 58929203) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-amino-5-[2-[(dimethylamino)methyl]phenoxy]-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-amino-5-[2-[(dimethylamino)methyl]phenoxy]-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 58929203 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-amino-5-[2-[(dimethylamino)methyl]phenoxy]-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(NC(=O)c2cc(Oc3ccccc3CN(C)C)ccc2N)n1 |
| InChI | InChI=1S/C20H22N4O2S/c1-13-12-27-20(22-13)23-19(25)16-10-15(8-9-17(16)21)26-18-7-5-4-6-14(18)11-24(2)3/h4-10,12H,11,21H2,1-3H3,(H,22,23,25) |
| InChIKey | ZTWOUOKMBNZHAO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|