C15H16N6OS2 — CID 23067463
2-amino-5-[(2,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 23067463) has the molecular formula C15H16N6OS2 and a molecular weight of 360.47 g/mol. Its IUPAC name is 2-amino-5-[(2,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-amino-5-[(2,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 23067463 |
| Molecular Formula | C15H16N6OS2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-amino-5-[(2,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(NC(=O)c2cc(Sc3nc(C)nn3C)ccc2N)n1 |
| InChI | InChI=1S/C15H16N6OS2/c1-8-7-23-14(17-8)19-13(22)11-6-10(4-5-12(11)16)24-15-18-9(2)20-21(15)3/h4-7H,16H2,1-3H3,(H,17,19,22) |
| InChIKey | JENOZCXGCVAYBH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|