C16H22ClNO2 — CID 23069452
ethyl N-[2-chloro-4-(1-methylcyclohexyl)phenyl]carbamate (PubChem CID 23069452) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is ethyl N-[2-chloro-4-(1-methylcyclohexyl)phenyl]carbamate.
| Compound Name | ethyl N-[2-chloro-4-(1-methylcyclohexyl)phenyl]carbamate |
|---|---|
| PubChem CID | 23069452 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | ethyl N-[2-chloro-4-(1-methylcyclohexyl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(C2(C)CCCCC2)cc1Cl |
| InChI | InChI=1S/C16H22ClNO2/c1-3-20-15(19)18-14-8-7-12(11-13(14)17)16(2)9-5-4-6-10-16/h7-8,11H,3-6,9-10H2,1-2H3,(H,18,19) |
| InChIKey | BNLVUIKEIZSJKY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |