C25H34N2O4 — CID 23071884
4-(2-ethylbutyl)-4-hydroxy-N-[3-(2-methoxyphenoxy)phenyl]piperidine-1-carboxamide (PubChem CID 23071884) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 4-(2-ethylbutyl)-4-hydroxy-N-[3-(2-methoxyphenoxy)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(2-ethylbutyl)-4-hydroxy-N-[3-(2-methoxyphenoxy)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 23071884 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 4-(2-ethylbutyl)-4-hydroxy-N-[3-(2-methoxyphenoxy)phenyl]piperidine-1-carboxamide |
| SMILES | CCC(CC)CC1(O)CCN(C(=O)Nc2cccc(Oc3ccccc3OC)c2)CC1 |
| InChI | InChI=1S/C25H34N2O4/c1-4-19(5-2)18-25(29)13-15-27(16-14-25)24(28)26-20-9-8-10-21(17-20)31-23-12-7-6-11-22(23)30-3/h6-12,17,19,29H,4-5,13-16,18H2,1-3H3,(H,26,28) |
| InChIKey | XZTHVJRBPXICES-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |