About 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride
3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride (PubChem CID 23073586) has the molecular formula C13H17BrCl3NO
and a molecular weight of 389.55 g/mol. Its IUPAC name is 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride.
Molecular Properties
| Compound Name | 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride |
| PubChem CID | 23073586 |
| Molecular Formula | C13H17BrCl3NO |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride |
| SMILES | Cl.Cl.O=C(Cl)c1ccc(CN2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C13H15BrClNO.2ClH/c14-12-8-10(13(15)17)4-5-11(12)9-16-6-2-1-3-7-16;;/h4-5,8H,1-3,6-7,9H2;2*1H |
| InChIKey | SNNOLMZYBDIDPA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride?
The IUPAC name of 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride (CID 23073586) is 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride.
What is the SMILES notation for 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride?
The canonical SMILES for 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride is Cl.Cl.O=C(Cl)c1ccc(CN2CCCCC2)c(Br)c1.
What is the InChIKey of 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride?
The InChIKey is SNNOLMZYBDIDPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrClNO.2ClH/c14-12-8-10(13(15)17)4-5-11(12)9-16-6-2-1-3-7-16;;/h4-5,8H,1-3,6-7,9H2;2*1H.
What are the key properties of 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride?
3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride has a molecular weight of 389.55 g/mol, XLogP of 4.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-(piperidin-1-ylmethyl)benzoyl chloride;dihydrochloride is sourced from PubChem (CID 23073586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).