About 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride
3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride (PubChem CID 23073503) has the molecular formula C13H18BrCl3N2O
and a molecular weight of 404.56 g/mol. Its IUPAC name is 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride.
Molecular Properties
| Compound Name | 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride |
| PubChem CID | 23073503 |
| Molecular Formula | C13H18BrCl3N2O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride |
| SMILES | CN1CCN(Cc2ccc(C(=O)Cl)cc2Br)CC1.Cl.Cl |
| InChI | InChI=1S/C13H16BrClN2O.2ClH/c1-16-4-6-17(7-5-16)9-11-3-2-10(13(15)18)8-12(11)14;;/h2-3,8H,4-7,9H2,1H3;2*1H |
| InChIKey | AMKKONOAMWIENE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride?
The IUPAC name of 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride (CID 23073503) is 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride.
What is the SMILES notation for 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride?
The canonical SMILES for 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride is CN1CCN(Cc2ccc(C(=O)Cl)cc2Br)CC1.Cl.Cl.
What is the InChIKey of 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride?
The InChIKey is AMKKONOAMWIENE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrClN2O.2ClH/c1-16-4-6-17(7-5-16)9-11-3-2-10(13(15)18)8-12(11)14;;/h2-3,8H,4-7,9H2,1H3;2*1H.
What are the key properties of 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride?
3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride has a molecular weight of 404.56 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride is sourced from PubChem (CID 23073503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).