C19H36N2+2 — CID 2307863
(5,5-dimethyl-3-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-dipropylazanium (PubChem CID 2307863) has the molecular formula C19H36N2+2 and a molecular weight of 292.51 g/mol. Its IUPAC name is (5,5-dimethyl-3-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-dipropylazanium.
| Compound Name | (5,5-dimethyl-3-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-dipropylazanium |
|---|---|
| PubChem CID | 2307863 |
| Molecular Formula | C19H36N2+2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | (5,5-dimethyl-3-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-dipropylazanium |
| SMILES | CCC[NH+](CCC)C1=CC(=[N+]2CCCCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H35N2/c1-5-10-20(11-6-2)17-14-18(16-19(3,4)15-17)21-12-8-7-9-13-21/h14H,5-13,15-16H2,1-4H3/q+1/p+1 |
| InChIKey | POGUETQKMGLOPZ-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 7.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|