C15H28N3+ — CID 4113719
2-(5,5-dimethyl-3-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine (PubChem CID 4113719) has the molecular formula C15H28N3+ and a molecular weight of 250.41 g/mol. Its IUPAC name is 2-(5,5-dimethyl-3-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(5,5-dimethyl-3-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 4113719 |
| Molecular Formula | C15H28N3+ |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 2-(5,5-dimethyl-3-piperidin-1-ium-1-ylidenecyclohexen-1-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NC1=CC(=[N+]2CCCCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H27N3/c1-15(2)11-13(16-17(3)4)10-14(12-15)18-8-6-5-7-9-18/h10H,5-9,11-12H2,1-4H3/p+1 |
| InChIKey | OWWKMNPPRNPJRQ-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|