C10H25O6P3 — CID 23081832
1,2,4-tris(dimethylphosphoryloxy)butane (PubChem CID 23081832) has the molecular formula C10H25O6P3 and a molecular weight of 334.23 g/mol. Its IUPAC name is 1,2,4-tris(dimethylphosphoryloxy)butane.
| Compound Name | 1,2,4-tris(dimethylphosphoryloxy)butane |
|---|---|
| PubChem CID | 23081832 |
| Molecular Formula | C10H25O6P3 |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 1,2,4-tris(dimethylphosphoryloxy)butane |
| SMILES | CP(C)(=O)OCCC(COP(C)(C)=O)OP(C)(C)=O |
| InChI | InChI=1S/C10H25O6P3/c1-17(2,11)14-8-7-10(16-19(5,6)13)9-15-18(3,4)12/h10H,7-9H2,1-6H3 |
| InChIKey | SGUQFIVTYOMIIA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|