C8H22NO6P2+ — CID 59991769
2,3-bis[[hydroxy(methyl)phosphoryl]oxy]propyl-trimethylazanium (PubChem CID 59991769) has the molecular formula C8H22NO6P2+ and a molecular weight of 290.21 g/mol. Its IUPAC name is 2,3-bis[[hydroxy(methyl)phosphoryl]oxy]propyl-trimethylazanium.
| Compound Name | 2,3-bis[[hydroxy(methyl)phosphoryl]oxy]propyl-trimethylazanium |
|---|---|
| PubChem CID | 59991769 |
| Molecular Formula | C8H22NO6P2+ |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2,3-bis[[hydroxy(methyl)phosphoryl]oxy]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CC(COP(C)(=O)O)OP(C)(=O)O |
| InChI | InChI=1S/C8H21NO6P2/c1-9(2,3)6-8(15-17(5,12)13)7-14-16(4,10)11/h8H,6-7H2,1-5H3,(H-,10,11,12,13)/p+1 |
| InChIKey | VMUSVXLUSRBMGR-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|