C9H23O6P3 — CID 23081815
1,2,3-tris(dimethylphosphoryloxy)propane (PubChem CID 23081815) has the molecular formula C9H23O6P3 and a molecular weight of 320.20 g/mol. Its IUPAC name is 1,2,3-tris(dimethylphosphoryloxy)propane.
| Compound Name | 1,2,3-tris(dimethylphosphoryloxy)propane |
|---|---|
| PubChem CID | 23081815 |
| Molecular Formula | C9H23O6P3 |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 1,2,3-tris(dimethylphosphoryloxy)propane |
| SMILES | CP(C)(=O)OCC(COP(C)(C)=O)OP(C)(C)=O |
| InChI | InChI=1S/C9H23O6P3/c1-16(2,10)13-7-9(15-18(5,6)12)8-14-17(3,4)11/h9H,7-8H2,1-6H3 |
| InChIKey | OIDNABLWRUEWEB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|