C16H36O4P2 — CID 23081866
1,2-bis[di(propan-2-yl)phosphoryloxy]butane (PubChem CID 23081866) has the molecular formula C16H36O4P2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1,2-bis[di(propan-2-yl)phosphoryloxy]butane.
| Compound Name | 1,2-bis[di(propan-2-yl)phosphoryloxy]butane |
|---|---|
| PubChem CID | 23081866 |
| Molecular Formula | C16H36O4P2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1,2-bis[di(propan-2-yl)phosphoryloxy]butane |
| SMILES | CCC(COP(=O)(C(C)C)C(C)C)OP(=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H36O4P2/c1-10-16(20-22(18,14(6)7)15(8)9)11-19-21(17,12(2)3)13(4)5/h12-16H,10-11H2,1-9H3 |
| InChIKey | IQAOMRCXMFOAIF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|