C20H18O4 — CID 23089256
diethyl 3-ethynyl-4-phenylbenzene-1,2-dicarboxylate (PubChem CID 23089256) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is diethyl 3-ethynyl-4-phenylbenzene-1,2-dicarboxylate.
| Compound Name | diethyl 3-ethynyl-4-phenylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23089256 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | diethyl 3-ethynyl-4-phenylbenzene-1,2-dicarboxylate |
| SMILES | C#Cc1c(-c2ccccc2)ccc(C(=O)OCC)c1C(=O)OCC |
| InChI | InChI=1S/C20H18O4/c1-4-15-16(14-10-8-7-9-11-14)12-13-17(19(21)23-5-2)18(15)20(22)24-6-3/h1,7-13H,5-6H2,2-3H3 |
| InChIKey | XARHSOUVVXPOJL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|