2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid

C11H9F2NO4 — CID 23092033

IUPAC2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid
SMILESO=C(O)C(c1ccc(F)c(F)c1)N1CCOC1=O
InChIInChI=1S/C11H9F2NO4/c12-7-2-1-6(5-8(7)13)9(10(15)16)14-3-4-18-11(14)17/h1-2,5,9H,3-4H2,(H,15,16)
InChIKeySBGYZQJZDRHJKK-UHFFFAOYSA-N
MW257.19 g/mol
LogP1.54
Rot. Bonds3

About 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid

2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid (PubChem CID 23092033) has the molecular formula C11H9F2NO4 and a molecular weight of 257.19 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid
PubChem CID23092033
Molecular FormulaC11H9F2NO4
Molecular Weight257.19 g/mol
Exact Mass257.05
IUPAC Name2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid
SMILESO=C(O)C(c1ccc(F)c(F)c1)N1CCOC1=O
InChIInChI=1S/C11H9F2NO4/c12-7-2-1-6(5-8(7)13)9(10(15)16)14-3-4-18-11(14)17/h1-2,5,9H,3-4H2,(H,15,16)
InChIKeySBGYZQJZDRHJKK-UHFFFAOYSA-N
XLogP1.54
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.19
LogP ≤ 51.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The IUPAC name of 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid (CID 23092033) is 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid.
What is the SMILES notation for 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The canonical SMILES for 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid is O=C(O)C(c1ccc(F)c(F)c1)N1CCOC1=O.
What is the InChIKey of 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The InChIKey is SBGYZQJZDRHJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NO4/c12-7-2-1-6(5-8(7)13)9(10(15)16)14-3-4-18-11(14)17/h1-2,5,9H,3-4H2,(H,15,16).
What are the key properties of 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid has a molecular weight of 257.19 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid is sourced from PubChem (CID 23092033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).