About 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid
2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid (PubChem CID 23092033) has the molecular formula C11H9F2NO4
and a molecular weight of 257.19 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid |
| PubChem CID | 23092033 |
| Molecular Formula | C11H9F2NO4 |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid |
| SMILES | O=C(O)C(c1ccc(F)c(F)c1)N1CCOC1=O |
| InChI | InChI=1S/C11H9F2NO4/c12-7-2-1-6(5-8(7)13)9(10(15)16)14-3-4-18-11(14)17/h1-2,5,9H,3-4H2,(H,15,16) |
| InChIKey | SBGYZQJZDRHJKK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The IUPAC name of 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid (CID 23092033) is 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid.
What is the SMILES notation for 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The canonical SMILES for 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid is O=C(O)C(c1ccc(F)c(F)c1)N1CCOC1=O.
What is the InChIKey of 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The InChIKey is SBGYZQJZDRHJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NO4/c12-7-2-1-6(5-8(7)13)9(10(15)16)14-3-4-18-11(14)17/h1-2,5,9H,3-4H2,(H,15,16).
What are the key properties of 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid has a molecular weight of 257.19 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid is sourced from PubChem (CID 23092033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).