2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid

C15H13NO4 — CID 19849098

IUPAC2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid
SMILESO=C(O)C(c1ccc2ccccc2c1)N1CCOC1=O
InChIInChI=1S/C15H13NO4/c17-14(18)13(16-7-8-20-15(16)19)12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8H2,(H,17,18)
InChIKeyLIZPPIPVFFXPJA-UHFFFAOYSA-N
MW271.27 g/mol
LogP2.42
Rot. Bonds3

About 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid

2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid (PubChem CID 19849098) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid.

Molecular Properties

Compound Name2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid
PubChem CID19849098
Molecular FormulaC15H13NO4
Molecular Weight271.27 g/mol
Exact Mass271.08
IUPAC Name2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid
SMILESO=C(O)C(c1ccc2ccccc2c1)N1CCOC1=O
InChIInChI=1S/C15H13NO4/c17-14(18)13(16-7-8-20-15(16)19)12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8H2,(H,17,18)
InChIKeyLIZPPIPVFFXPJA-UHFFFAOYSA-N
XLogP2.42
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.27
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The IUPAC name of 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid (CID 19849098) is 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid.
What is the SMILES notation for 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The canonical SMILES for 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid is O=C(O)C(c1ccc2ccccc2c1)N1CCOC1=O.
What is the InChIKey of 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
The InChIKey is LIZPPIPVFFXPJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c17-14(18)13(16-7-8-20-15(16)19)12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8H2,(H,17,18).
What are the key properties of 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid?
2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid has a molecular weight of 271.27 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-2-yl-2-(2-oxo-1,3-oxazolidin-3-yl)acetic acid is sourced from PubChem (CID 19849098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).