C21H22N2OS2 — CID 23093806
N-(4-tert-butylphenyl)-5-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide (PubChem CID 23093806) has the molecular formula C21H22N2OS2 and a molecular weight of 382.55 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-5-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-5-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23093806 |
| Molecular Formula | C21H22N2OS2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-(4-tert-butylphenyl)-5-(pyridin-4-ylmethylsulfanyl)thiophene-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2ccc(SCc3ccncc3)s2)cc1 |
| InChI | InChI=1S/C21H22N2OS2/c1-21(2,3)16-4-6-17(7-5-16)23-20(24)18-8-9-19(26-18)25-14-15-10-12-22-13-11-15/h4-13H,14H2,1-3H3,(H,23,24) |
| InChIKey | MYLKXMGWDFAMMK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |