C26H21N3OS2 — CID 23094859
2-(4-aminophenyl)sulfanyl-N-[3-cyano-4-(4-methylphenyl)thiophen-2-yl]-2-phenylacetamide (PubChem CID 23094859) has the molecular formula C26H21N3OS2 and a molecular weight of 455.61 g/mol. Its IUPAC name is 2-(4-aminophenyl)sulfanyl-N-[3-cyano-4-(4-methylphenyl)thiophen-2-yl]-2-phenylacetamide.
| Compound Name | 2-(4-aminophenyl)sulfanyl-N-[3-cyano-4-(4-methylphenyl)thiophen-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 23094859 |
| Molecular Formula | C26H21N3OS2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-(4-aminophenyl)sulfanyl-N-[3-cyano-4-(4-methylphenyl)thiophen-2-yl]-2-phenylacetamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)C(Sc3ccc(N)cc3)c3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C26H21N3OS2/c1-17-7-9-18(10-8-17)23-16-31-26(22(23)15-27)29-25(30)24(19-5-3-2-4-6-19)32-21-13-11-20(28)12-14-21/h2-14,16,24H,28H2,1H3,(H,29,30) |
| InChIKey | FMICAJPMGPDYHT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|