C20H17ClN2O3S3 — CID 2310061
[(3aR,9bS)-4,4,8-trimethyl-1-sulfanylidene-3a,9b-dihydrodithiolo[3,4-c]quinolin-5-yl]-(4-chloro-3-nitrophenyl)methanone (PubChem CID 2310061) has the molecular formula C20H17ClN2O3S3 and a molecular weight of 465.02 g/mol. Its IUPAC name is [(3aR,9bS)-4,4,8-trimethyl-1-sulfanylidene-3a,9b-dihydrodithiolo[3,4-c]quinolin-5-yl]-(4-chloro-3-nitrophenyl)methanone.
| Compound Name | [(3aR,9bS)-4,4,8-trimethyl-1-sulfanylidene-3a,9b-dihydrodithiolo[3,4-c]quinolin-5-yl]-(4-chloro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 2310061 |
| Molecular Formula | C20H17ClN2O3S3 |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | [(3aR,9bS)-4,4,8-trimethyl-1-sulfanylidene-3a,9b-dihydrodithiolo[3,4-c]quinolin-5-yl]-(4-chloro-3-nitrophenyl)methanone |
| SMILES | Cc1ccc2c(c1)[C@@H]1C(=S)SS[C@H]1C(C)(C)N2C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17ClN2O3S3/c1-10-4-7-14-12(8-10)16-17(28-29-19(16)27)20(2,3)22(14)18(24)11-5-6-13(21)15(9-11)23(25)26/h4-9,16-17H,1-3H3/t16-,17+/m0/s1 |
| InChIKey | UBFRPHDXYJIIDV-DLBZAZTESA-N |
| XLogP | 6.17 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|