C20H19BrN2O2S2 — CID 23101964
[2-(4-bromophenyl)-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate (PubChem CID 23101964) has the molecular formula C20H19BrN2O2S2 and a molecular weight of 463.42 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
|---|---|
| PubChem CID | 23101964 |
| Molecular Formula | C20H19BrN2O2S2 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
| SMILES | O=C(CSC(=S)N1CC2CC(C1)c1cccc(=O)n1C2)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H19BrN2O2S2/c21-16-6-4-14(5-7-16)18(24)12-27-20(26)22-9-13-8-15(11-22)17-2-1-3-19(25)23(17)10-13/h1-7,13,15H,8-12H2 |
| InChIKey | ZYPMQDYXPQGRIY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|