C22H25N3O2S2 — CID 23101927
[2-(3,5-dimethylanilino)-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate (PubChem CID 23101927) has the molecular formula C22H25N3O2S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is [2-(3,5-dimethylanilino)-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate.
| Compound Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
|---|---|
| PubChem CID | 23101927 |
| Molecular Formula | C22H25N3O2S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
| SMILES | Cc1cc(C)cc(NC(=O)CSC(=S)N2CC3CC(C2)c2cccc(=O)n2C3)c1 |
| InChI | InChI=1S/C22H25N3O2S2/c1-14-6-15(2)8-18(7-14)23-20(26)13-29-22(28)24-10-16-9-17(12-24)19-4-3-5-21(27)25(19)11-16/h3-8,16-17H,9-13H2,1-2H3,(H,23,26) |
| InChIKey | ZUDSMDBWWPASBD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|