C22H23N3O4S2 — CID 99129276
[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate (PubChem CID 99129276) has the molecular formula C22H23N3O4S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
|---|---|
| PubChem CID | 99129276 |
| Molecular Formula | C22H23N3O4S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
| SMILES | O=C(CSC(=S)N1C[C@@H]2C[C@@H](C1)c1cccc(=O)n1C2)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H23N3O4S2/c26-20(23-16-4-5-18-19(9-16)29-7-6-28-18)13-31-22(30)24-10-14-8-15(12-24)17-2-1-3-21(27)25(17)11-14/h1-5,9,14-15H,6-8,10-13H2,(H,23,26)/t14-,15-/m0/s1 |
| InChIKey | AGRSGPXAEMARLR-GJZGRUSLSA-N |
| XLogP | 2.70 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|