C23H22N4O2S2 — CID 23102082
[2-oxo-2-(quinolin-3-ylamino)ethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate (PubChem CID 23102082) has the molecular formula C23H22N4O2S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is [2-oxo-2-(quinolin-3-ylamino)ethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate.
| Compound Name | [2-oxo-2-(quinolin-3-ylamino)ethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
|---|---|
| PubChem CID | 23102082 |
| Molecular Formula | C23H22N4O2S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [2-oxo-2-(quinolin-3-ylamino)ethyl] 6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
| SMILES | O=C(CSC(=S)N1CC2CC(C1)c1cccc(=O)n1C2)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C23H22N4O2S2/c28-21(25-18-9-16-4-1-2-5-19(16)24-10-18)14-31-23(30)26-11-15-8-17(13-26)20-6-3-7-22(29)27(20)12-15/h1-7,9-10,15,17H,8,11-14H2,(H,25,28) |
| InChIKey | NAQAXFPUGKNSRY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|